C17H22N6O3 — CID 177037759
ethane;3-methyl-6-[4-nitro-1-(oxan-2-yl)pyrazol-3-yl]-2H-pyrazolo[4,3-c]pyridine (PubChem CID 177037759) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is ethane;3-methyl-6-[4-nitro-1-(oxan-2-yl)pyrazol-3-yl]-2H-pyrazolo[4,3-c]pyridine.
| Compound Name | ethane;3-methyl-6-[4-nitro-1-(oxan-2-yl)pyrazol-3-yl]-2H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 177037759 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | ethane;3-methyl-6-[4-nitro-1-(oxan-2-yl)pyrazol-3-yl]-2H-pyrazolo[4,3-c]pyridine |
| SMILES | CC.Cc1[nH]nc2cc(-c3nn(C4CCCCO4)cc3[N+](=O)[O-])ncc12 |
| InChI | InChI=1S/C15H16N6O3.C2H6/c1-9-10-7-16-12(6-11(10)18-17-9)15-13(21(22)23)8-20(19-15)14-4-2-3-5-24-14;1-2/h6-8,14H,2-5H2,1H3,(H,17,18);1-2H3 |
| InChIKey | HVGUFENPXWUZKX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|