C16H20Cl2N6O6 — CID 167698127
3-chloro-4-nitro-1-(oxan-2-yl)pyrazole;5-chloro-4-nitro-1H-pyrazole;3,4-dihydro-2H-pyran (PubChem CID 167698127) has the molecular formula C16H20Cl2N6O6 and a molecular weight of 463.28 g/mol. Its IUPAC name is 3-chloro-4-nitro-1-(oxan-2-yl)pyrazole;5-chloro-4-nitro-1H-pyrazole;3,4-dihydro-2H-pyran.
| Compound Name | 3-chloro-4-nitro-1-(oxan-2-yl)pyrazole;5-chloro-4-nitro-1H-pyrazole;3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 167698127 |
| Molecular Formula | C16H20Cl2N6O6 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 3-chloro-4-nitro-1-(oxan-2-yl)pyrazole;5-chloro-4-nitro-1H-pyrazole;3,4-dihydro-2H-pyran |
| SMILES | C1=COCCC1.O=[N+]([O-])c1cn(C2CCCCO2)nc1Cl.O=[N+]([O-])c1cn[nH]c1Cl |
| InChI | InChI=1S/C8H10ClN3O3.C5H8O.C3H2ClN3O2/c9-8-6(12(13)14)5-11(10-8)7-3-1-2-4-15-7;1-2-4-6-5-3-1;4-3-2(7(8)9)1-5-6-3/h5,7H,1-4H2;2,4H,1,3,5H2;1H,(H,5,6) |
| InChIKey | XYWRXCXNPRLGPH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 151.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|