C16H25N5O6 — CID 122604704
tert-butyl 4-[3-(ethoxycarbonylamino)-4-nitropyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 122604704) has the molecular formula C16H25N5O6 and a molecular weight of 383.41 g/mol. Its IUPAC name is tert-butyl 4-[3-(ethoxycarbonylamino)-4-nitropyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(ethoxycarbonylamino)-4-nitropyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 122604704 |
| Molecular Formula | C16H25N5O6 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl 4-[3-(ethoxycarbonylamino)-4-nitropyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)Nc1nn(C2CCN(C(=O)OC(C)(C)C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N5O6/c1-5-26-14(22)17-13-12(21(24)25)10-20(18-13)11-6-8-19(9-7-11)15(23)27-16(2,3)4/h10-11H,5-9H2,1-4H3,(H,17,18,22) |
| InChIKey | CQXMUTAVMCCWMB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|