C25H31N7O5 — CID 158983650
tert-butyl 4-[4-[[4-(4-methoxyanilino)-5-nitropyrimidin-2-yl]methyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 158983650) has the molecular formula C25H31N7O5 and a molecular weight of 509.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-(4-methoxyanilino)-5-nitropyrimidin-2-yl]methyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-(4-methoxyanilino)-5-nitropyrimidin-2-yl]methyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 158983650 |
| Molecular Formula | C25H31N7O5 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | tert-butyl 4-[4-[[4-(4-methoxyanilino)-5-nitropyrimidin-2-yl]methyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | COc1ccc(Nc2nc(Cc3cnn(C4CCN(C(=O)OC(C)(C)C)CC4)c3)ncc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H31N7O5/c1-25(2,3)37-24(33)30-11-9-19(10-12-30)31-16-17(14-27-31)13-22-26-15-21(32(34)35)23(29-22)28-18-5-7-20(36-4)8-6-18/h5-8,14-16,19H,9-13H2,1-4H3,(H,26,28,29) |
| InChIKey | NPKFPAVUIVSNSQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|