C22H28N6O4 — CID 144695472
tert-butyl (2R,3R)-2-[[4-(4-methylanilino)-5-nitropyrimidin-2-yl]amino]-5-azaspiro[2.4]heptane-5-carboxylate (PubChem CID 144695472) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-[[4-(4-methylanilino)-5-nitropyrimidin-2-yl]amino]-5-azaspiro[2.4]heptane-5-carboxylate.
| Compound Name | tert-butyl (2R,3R)-2-[[4-(4-methylanilino)-5-nitropyrimidin-2-yl]amino]-5-azaspiro[2.4]heptane-5-carboxylate |
|---|---|
| PubChem CID | 144695472 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | tert-butyl (2R,3R)-2-[[4-(4-methylanilino)-5-nitropyrimidin-2-yl]amino]-5-azaspiro[2.4]heptane-5-carboxylate |
| SMILES | Cc1ccc(Nc2nc(N[C@@H]3C[C@@]34CCN(C(=O)OC(C)(C)C)C4)ncc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H28N6O4/c1-14-5-7-15(8-6-14)24-18-16(28(30)31)12-23-19(26-18)25-17-11-22(17)9-10-27(13-22)20(29)32-21(2,3)4/h5-8,12,17H,9-11,13H2,1-4H3,(H2,23,24,25,26)/t17-,22-/m1/s1 |
| InChIKey | VIZXDUICDJCFAQ-VGOFRKELSA-N |
| XLogP | 4.25 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|