C21H23F3N4O4 — CID 178148027
tert-butyl 3-[4-[[3-nitro-6-(trifluoromethyl)-2-pyridinyl]amino]phenyl]pyrrolidine-1-carboxylate (PubChem CID 178148027) has the molecular formula C21H23F3N4O4 and a molecular weight of 452.43 g/mol. Its IUPAC name is tert-butyl 3-[4-[[3-nitro-6-(trifluoromethyl)-2-pyridinyl]amino]phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[[3-nitro-6-(trifluoromethyl)-2-pyridinyl]amino]phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178148027 |
| Molecular Formula | C21H23F3N4O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | tert-butyl 3-[4-[[3-nitro-6-(trifluoromethyl)-2-pyridinyl]amino]phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(Nc3nc(C(F)(F)F)ccc3[N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C21H23F3N4O4/c1-20(2,3)32-19(29)27-11-10-14(12-27)13-4-6-15(7-5-13)25-18-16(28(30)31)8-9-17(26-18)21(22,23)24/h4-9,14H,10-12H2,1-3H3,(H,25,26) |
| InChIKey | AJTBZICEPZEFSC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|