C29H36N6O4 — CID 169082148
tert-butyl 2-ethyl-4-[6-[6-(methoxymethoxy)-2-methylindazol-5-yl]-1,5-naphthyridin-2-yl]piperazine-1-carboxylate (PubChem CID 169082148) has the molecular formula C29H36N6O4 and a molecular weight of 532.65 g/mol. Its IUPAC name is tert-butyl 2-ethyl-4-[6-[6-(methoxymethoxy)-2-methylindazol-5-yl]-1,5-naphthyridin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-ethyl-4-[6-[6-(methoxymethoxy)-2-methylindazol-5-yl]-1,5-naphthyridin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169082148 |
| Molecular Formula | C29H36N6O4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | tert-butyl 2-ethyl-4-[6-[6-(methoxymethoxy)-2-methylindazol-5-yl]-1,5-naphthyridin-2-yl]piperazine-1-carboxylate |
| SMILES | CCC1CN(c2ccc3nc(-c4cc5cn(C)nc5cc4OCOC)ccc3n2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H36N6O4/c1-7-20-17-34(12-13-35(20)28(36)39-29(2,3)4)27-11-10-23-24(31-27)9-8-22(30-23)21-14-19-16-33(5)32-25(19)15-26(21)38-18-37-6/h8-11,14-16,20H,7,12-13,17-18H2,1-6H3 |
| InChIKey | IWLOWIZPHZBSPL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|