C27H34N6O2 — CID 162433469
N-tert-butyl-1-[6-[6-(methoxymethoxy)-2,7-dimethylindazol-5-yl]-1,5-naphthyridin-2-yl]pyrrolidin-3-amine (PubChem CID 162433469) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-tert-butyl-1-[6-[6-(methoxymethoxy)-2,7-dimethylindazol-5-yl]-1,5-naphthyridin-2-yl]pyrrolidin-3-amine.
| Compound Name | N-tert-butyl-1-[6-[6-(methoxymethoxy)-2,7-dimethylindazol-5-yl]-1,5-naphthyridin-2-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 162433469 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | N-tert-butyl-1-[6-[6-(methoxymethoxy)-2,7-dimethylindazol-5-yl]-1,5-naphthyridin-2-yl]pyrrolidin-3-amine |
| SMILES | COCOc1c(-c2ccc3nc(N4CCC(NC(C)(C)C)C4)ccc3n2)cc2cn(C)nc2c1C |
| InChI | InChI=1S/C27H34N6O2/c1-17-25-18(14-32(5)31-25)13-20(26(17)35-16-34-6)21-7-8-23-22(28-21)9-10-24(29-23)33-12-11-19(15-33)30-27(2,3)4/h7-10,13-14,19,30H,11-12,15-16H2,1-6H3 |
| InChIKey | ASPSXEXVFOLIMM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|