C28H33N5O4 — CID 175486541
tert-butyl N-[(3S)-1-[6-[6-(methoxymethoxy)-2-methyl-1H-indol-5-yl]-1,5-naphthyridin-2-yl]pyrrolidin-3-yl]carbamate (PubChem CID 175486541) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[6-[6-(methoxymethoxy)-2-methyl-1H-indol-5-yl]-1,5-naphthyridin-2-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[6-[6-(methoxymethoxy)-2-methyl-1H-indol-5-yl]-1,5-naphthyridin-2-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 175486541 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | tert-butyl N-[(3S)-1-[6-[6-(methoxymethoxy)-2-methyl-1H-indol-5-yl]-1,5-naphthyridin-2-yl]pyrrolidin-3-yl]carbamate |
| SMILES | COCOc1cc2[nH]c(C)cc2cc1-c1ccc2nc(N3CC[C@H](NC(=O)OC(C)(C)C)C3)ccc2n1 |
| InChI | InChI=1S/C28H33N5O4/c1-17-12-18-13-20(25(36-16-35-5)14-24(18)29-17)21-6-7-23-22(31-21)8-9-26(32-23)33-11-10-19(15-33)30-27(34)37-28(2,3)4/h6-9,12-14,19,29H,10-11,15-16H2,1-5H3,(H,30,34)/t19-/m0/s1 |
| InChIKey | HLWUYKXCIUVRQD-IBGZPJMESA-N |
| XLogP | 5.17 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|