C28H31N5O4 — CID 168895317
tert-butyl 3-[6-[2-(methoxymethoxy)-4-(2-methylindazol-5-yl)phenyl]pyridazin-3-yl]azetidine-1-carboxylate (PubChem CID 168895317) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is tert-butyl 3-[6-[2-(methoxymethoxy)-4-(2-methylindazol-5-yl)phenyl]pyridazin-3-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-[2-(methoxymethoxy)-4-(2-methylindazol-5-yl)phenyl]pyridazin-3-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 168895317 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | tert-butyl 3-[6-[2-(methoxymethoxy)-4-(2-methylindazol-5-yl)phenyl]pyridazin-3-yl]azetidine-1-carboxylate |
| SMILES | COCOc1cc(-c2ccc3nn(C)cc3c2)ccc1-c1ccc(C2CN(C(=O)OC(C)(C)C)C2)nn1 |
| InChI | InChI=1S/C28H31N5O4/c1-28(2,3)37-27(34)33-15-21(16-33)23-10-11-25(30-29-23)22-8-6-19(13-26(22)36-17-35-5)18-7-9-24-20(12-18)14-32(4)31-24/h6-14,21H,15-17H2,1-5H3 |
| InChIKey | MCNVPHXXJGQFNA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|