C19H29F3N2O4 — CID 165115130
tert-butyl 3-[5-(methoxymethoxy)-4-methyl-6-(trifluoromethyl)-2-pyridinyl]azetidine-1-carboxylate;ethane (PubChem CID 165115130) has the molecular formula C19H29F3N2O4 and a molecular weight of 406.45 g/mol. Its IUPAC name is tert-butyl 3-[5-(methoxymethoxy)-4-methyl-6-(trifluoromethyl)-2-pyridinyl]azetidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-[5-(methoxymethoxy)-4-methyl-6-(trifluoromethyl)-2-pyridinyl]azetidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 165115130 |
| Molecular Formula | C19H29F3N2O4 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | tert-butyl 3-[5-(methoxymethoxy)-4-methyl-6-(trifluoromethyl)-2-pyridinyl]azetidine-1-carboxylate;ethane |
| SMILES | CC.COCOc1c(C)cc(C2CN(C(=O)OC(C)(C)C)C2)nc1C(F)(F)F |
| InChI | InChI=1S/C17H23F3N2O4.C2H6/c1-10-6-12(11-7-22(8-11)15(23)26-16(2,3)4)21-14(17(18,19)20)13(10)25-9-24-5;1-2/h6,11H,7-9H2,1-5H3;1-2H3 |
| InChIKey | SKZMBWZNNJZNQM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|