C31H38N6O4S — CID 166459604
tert-butyl 4-[2-[12-[2-(methoxymethoxy)phenyl]-3-methyl-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-4-yl]-1,3-thiazol-5-yl]piperidine-1-carboxylate (PubChem CID 166459604) has the molecular formula C31H38N6O4S and a molecular weight of 590.75 g/mol. Its IUPAC name is tert-butyl 4-[2-[12-[2-(methoxymethoxy)phenyl]-3-methyl-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-4-yl]-1,3-thiazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[12-[2-(methoxymethoxy)phenyl]-3-methyl-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-4-yl]-1,3-thiazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166459604 |
| Molecular Formula | C31H38N6O4S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | tert-butyl 4-[2-[12-[2-(methoxymethoxy)phenyl]-3-methyl-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-4-yl]-1,3-thiazol-5-yl]piperidine-1-carboxylate |
| SMILES | COCOc1ccccc1-c1cc2c3c([nH]c2nn1)CCN(c1ncc(C2CCN(C(=O)OC(C)(C)C)CC2)s1)C3C |
| InChI | InChI=1S/C31H38N6O4S/c1-19-27-22-16-24(21-8-6-7-9-25(21)40-18-39-5)34-35-28(22)33-23(27)12-15-37(19)29-32-17-26(42-29)20-10-13-36(14-11-20)30(38)41-31(2,3)4/h6-9,16-17,19-20H,10-15,18H2,1-5H3,(H,33,35) |
| InChIKey | WXPDJHGJYOWLLZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|