C28H39N7O5 — CID 166458633
tert-butyl 4-[2-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]acetyl]piperazine-1-carboxylate (PubChem CID 166458633) has the molecular formula C28H39N7O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is tert-butyl 4-[2-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]acetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166458633 |
| Molecular Formula | C28H39N7O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | tert-butyl 4-[2-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]acetyl]piperazine-1-carboxylate |
| SMILES | COCOc1ccccc1-c1cc2c(nn1)NC[C@H]1CN(CC(=O)N3CCN(C(=O)OC(C)(C)C)CC3)CCN21 |
| InChI | InChI=1S/C28H39N7O5/c1-28(2,3)40-27(37)34-12-10-33(11-13-34)25(36)18-32-9-14-35-20(17-32)16-29-26-23(35)15-22(30-31-26)21-7-5-6-8-24(21)39-19-38-4/h5-8,15,20H,9-14,16-19H2,1-4H3,(H,29,31)/t20-/m0/s1 |
| InChIKey | NZRGFWHAPINOMZ-FQEVSTJZSA-N |
| XLogP | 2.12 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|