C30H36N6O4 — CID 166459641
benzyl 4-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidine-1-carboxylate (PubChem CID 166459641) has the molecular formula C30H36N6O4 and a molecular weight of 544.66 g/mol. Its IUPAC name is benzyl 4-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166459641 |
| Molecular Formula | C30H36N6O4 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | benzyl 4-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidine-1-carboxylate |
| SMILES | COCOc1ccccc1-c1cc2c(nn1)NC[C@H]1CN(C3CCN(C(=O)OCc4ccccc4)CC3)CCN21 |
| InChI | InChI=1S/C30H36N6O4/c1-38-21-40-28-10-6-5-9-25(28)26-17-27-29(33-32-26)31-18-24-19-35(15-16-36(24)27)23-11-13-34(14-12-23)30(37)39-20-22-7-3-2-4-8-22/h2-10,17,23-24H,11-16,18-21H2,1H3,(H,31,33)/t24-/m0/s1 |
| InChIKey | GEOPGDHQZZWQAU-DEOSSOPVSA-N |
| XLogP | 3.84 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|