C25H29N5O2 — CID 176564021
4-(8-benzyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[2-(methoxymethoxy)phenyl]pyridazin-3-amine (PubChem CID 176564021) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-(8-benzyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[2-(methoxymethoxy)phenyl]pyridazin-3-amine.
| Compound Name | 4-(8-benzyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[2-(methoxymethoxy)phenyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 176564021 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 4-(8-benzyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[2-(methoxymethoxy)phenyl]pyridazin-3-amine |
| SMILES | COCOc1ccccc1-c1cc(N2CC3CCC(C2)N3Cc2ccccc2)c(N)nn1 |
| InChI | InChI=1S/C25H29N5O2/c1-31-17-32-24-10-6-5-9-21(24)22-13-23(25(26)28-27-22)29-15-19-11-12-20(16-29)30(19)14-18-7-3-2-4-8-18/h2-10,13,19-20H,11-12,14-17H2,1H3,(H2,26,28) |
| InChIKey | DZPZUALWEZQCBR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|