C23H25N5O — CID 137029430
2-[5-[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-aminopyridazin-3-yl]phenol (PubChem CID 137029430) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[5-[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-aminopyridazin-3-yl]phenol.
| Compound Name | 2-[5-[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-aminopyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 137029430 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-[5-[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-6-aminopyridazin-3-yl]phenol |
| SMILES | Nc1nnc(-c2ccccc2O)cc1N1C[C@H]2CN(Cc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C23H25N5O/c24-23-21(10-20(25-26-23)19-8-4-5-9-22(19)29)28-14-17-12-27(13-18(17)15-28)11-16-6-2-1-3-7-16/h1-10,17-18,29H,11-15H2,(H2,24,26)/t17-,18+ |
| InChIKey | HYFYBIOFAMANIC-HDICACEKSA-N |
| XLogP | 3.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |