C34H45N7O4 — CID 177309508
tert-butyl 3-[4-[[4-[3-amino-6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]piperazin-1-yl]methyl]phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 177309508) has the molecular formula C34H45N7O4 and a molecular weight of 615.78 g/mol. Its IUPAC name is tert-butyl 3-[4-[[4-[3-amino-6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]piperazin-1-yl]methyl]phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[4-[[4-[3-amino-6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]piperazin-1-yl]methyl]phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 177309508 |
| Molecular Formula | C34H45N7O4 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.35 |
| IUPAC Name | tert-butyl 3-[4-[[4-[3-amino-6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]piperazin-1-yl]methyl]phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COCOc1ccccc1-c1cc(N2CCN(Cc3ccc(N4CC5CCC(C4)N5C(=O)OC(C)(C)C)cc3)CC2)c(N)nn1 |
| InChI | InChI=1S/C34H45N7O4/c1-34(2,3)45-33(42)41-26-13-14-27(41)22-40(21-26)25-11-9-24(10-12-25)20-38-15-17-39(18-16-38)30-19-29(36-37-32(30)35)28-7-5-6-8-31(28)44-23-43-4/h5-12,19,26-27H,13-18,20-23H2,1-4H3,(H2,35,37) |
| InChIKey | LEMKXIRQHOVGBA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|