C21H27N7O2 — CID 167063587
4-(2-hydroxyphenyl)-N-piperidin-4-yl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxamide (PubChem CID 167063587) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N-piperidin-4-yl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxamide.
| Compound Name | 4-(2-hydroxyphenyl)-N-piperidin-4-yl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 167063587 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N-piperidin-4-yl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxamide |
| SMILES | O=C(NC1CCNCC1)N1CCN2c3cc(-c4ccccc4O)nnc3NCC2C1 |
| InChI | InChI=1S/C21H27N7O2/c29-19-4-2-1-3-16(19)17-11-18-20(26-25-17)23-12-15-13-27(9-10-28(15)18)21(30)24-14-5-7-22-8-6-14/h1-4,11,14-15,22,29H,5-10,12-13H2,(H,23,26)(H,24,30) |
| InChIKey | TZBBMPXOCJGFAS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |