C21H26N6O2 — CID 166459952
[(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]-[(3S)-piperidin-3-yl]methanone (PubChem CID 166459952) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is [(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]-[(3S)-piperidin-3-yl]methanone.
| Compound Name | [(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]-[(3S)-piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 166459952 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]-[(3S)-piperidin-3-yl]methanone |
| SMILES | O=C([C@H]1CCCNC1)N1CCN2c3cc(-c4ccccc4O)nnc3NC[C@H]2C1 |
| InChI | InChI=1S/C21H26N6O2/c28-19-6-2-1-5-16(19)17-10-18-20(25-24-17)23-12-15-13-26(8-9-27(15)18)21(29)14-4-3-7-22-11-14/h1-2,5-6,10,14-15,22,28H,3-4,7-9,11-13H2,(H,23,25)/t14-,15-/m0/s1 |
| InChIKey | GTXGUEQYZHFTJX-GJZGRUSLSA-N |
| XLogP | 1.29 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |