C21H27N7O2 — CID 163294565
1,4-diazepan-1-yl-[(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]methanone (PubChem CID 163294565) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]methanone |
|---|---|
| PubChem CID | 163294565 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1,4-diazepan-1-yl-[(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]methanone |
| SMILES | O=C(N1CCCNCC1)N1CCN2c3cc(-c4ccccc4O)nnc3NC[C@H]2C1 |
| InChI | InChI=1S/C21H27N7O2/c29-19-5-2-1-4-16(19)17-12-18-20(25-24-17)23-13-15-14-27(10-11-28(15)18)21(30)26-8-3-6-22-7-9-26/h1-2,4-5,12,15,22,29H,3,6-11,13-14H2,(H,23,25)/t15-/m0/s1 |
| InChIKey | BLEDKVAIECYDAP-HNNXBMFYSA-N |
| XLogP | 1.18 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |