C18H21N5O — CID 156562291
2-spiro[1,5,6,8-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12,3'-azetidine]-4-ylphenol (PubChem CID 156562291) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-spiro[1,5,6,8-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12,3'-azetidine]-4-ylphenol.
| Compound Name | 2-spiro[1,5,6,8-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12,3'-azetidine]-4-ylphenol |
|---|---|
| PubChem CID | 156562291 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-spiro[1,5,6,8-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12,3'-azetidine]-4-ylphenol |
| SMILES | Oc1ccccc1-c1cc2c(nn1)NCC1CC3(CCN21)CNC3 |
| InChI | InChI=1S/C18H21N5O/c24-16-4-2-1-3-13(16)14-7-15-17(22-21-14)20-9-12-8-18(10-19-11-18)5-6-23(12)15/h1-4,7,12,19,24H,5-6,8-11H2,(H,20,22) |
| InChIKey | ITUGKIXNIHSRFY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |