C20H28N6O — CID 170613107
2-[(10S)-12-[3-(ethylamino)propyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol (PubChem CID 170613107) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 2-[(10S)-12-[3-(ethylamino)propyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol.
| Compound Name | 2-[(10S)-12-[3-(ethylamino)propyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol |
|---|---|
| PubChem CID | 170613107 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 2-[(10S)-12-[3-(ethylamino)propyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol |
| SMILES | CCNCCCN1CCN2c3cc(-c4ccccc4O)nnc3NC[C@H]2C1 |
| InChI | InChI=1S/C20H28N6O/c1-2-21-8-5-9-25-10-11-26-15(14-25)13-22-20-18(26)12-17(23-24-20)16-6-3-4-7-19(16)27/h3-4,6-7,12,15,21,27H,2,5,8-11,13-14H2,1H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | SHRYIVQMGZSBQV-HNNXBMFYSA-N |
| XLogP | 1.76 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|