C22H30N6O — CID 167401087
2-[(10S)-12-[(3-methylpiperidin-4-yl)methyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol (PubChem CID 167401087) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[(10S)-12-[(3-methylpiperidin-4-yl)methyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol.
| Compound Name | 2-[(10S)-12-[(3-methylpiperidin-4-yl)methyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol |
|---|---|
| PubChem CID | 167401087 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2-[(10S)-12-[(3-methylpiperidin-4-yl)methyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol |
| SMILES | CC1CNCCC1CN1CCN2c3cc(-c4ccccc4O)nnc3NC[C@H]2C1 |
| InChI | InChI=1S/C22H30N6O/c1-15-11-23-7-6-16(15)13-27-8-9-28-17(14-27)12-24-22-20(28)10-19(25-26-22)18-4-2-3-5-21(18)29/h2-5,10,15-17,23,29H,6-9,11-14H2,1H3,(H,24,26)/t15?,16?,17-/m0/s1 |
| InChIKey | MMLYOCSCRDNJPQ-JCYILVPMSA-N |
| XLogP | 2.01 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |