C17H21N5O — CID 163294505
2-(13-ethyl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl)phenol (PubChem CID 163294505) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-(13-ethyl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl)phenol.
| Compound Name | 2-(13-ethyl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl)phenol |
|---|---|
| PubChem CID | 163294505 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-(13-ethyl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl)phenol |
| SMILES | CCC1CN2c3cc(-c4ccccc4O)nnc3NCC2CN1 |
| InChI | InChI=1S/C17H21N5O/c1-2-11-10-22-12(8-18-11)9-19-17-15(22)7-14(20-21-17)13-5-3-4-6-16(13)23/h3-7,11-12,18,23H,2,8-10H2,1H3,(H,19,21) |
| InChIKey | MPZAIJZFTBHTHK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |