C15H14N4O2 — CID 156562180
12-(2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-3-one (PubChem CID 156562180) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 12-(2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-3-one.
| Compound Name | 12-(2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-3-one |
|---|---|
| PubChem CID | 156562180 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 12-(2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-3-one |
| SMILES | O=C1CCC2CNc3nnc(-c4ccccc4O)cc3N12 |
| InChI | InChI=1S/C15H14N4O2/c20-13-4-2-1-3-10(13)11-7-12-15(18-17-11)16-8-9-5-6-14(21)19(9)12/h1-4,7,9,20H,5-6,8H2,(H,16,18) |
| InChIKey | JBFJASBYFGFQHC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |