C26H30N8O — CID 163294523
2-[(10S)-12-[5-[(E)-2-piperidin-4-ylethenyl]pyrimidin-2-yl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol (PubChem CID 163294523) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 2-[(10S)-12-[5-[(E)-2-piperidin-4-ylethenyl]pyrimidin-2-yl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol.
| Compound Name | 2-[(10S)-12-[5-[(E)-2-piperidin-4-ylethenyl]pyrimidin-2-yl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol |
|---|---|
| PubChem CID | 163294523 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[(10S)-12-[5-[(E)-2-piperidin-4-ylethenyl]pyrimidin-2-yl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]phenol |
| SMILES | Oc1ccccc1-c1cc2c(nn1)NC[C@H]1CN(c3ncc(/C=C/C4CCNCC4)cn3)CCN21 |
| InChI | InChI=1S/C26H30N8O/c35-24-4-2-1-3-21(24)22-13-23-25(32-31-22)28-16-20-17-33(11-12-34(20)23)26-29-14-19(15-30-26)6-5-18-7-9-27-10-8-18/h1-6,13-15,18,20,27,35H,7-12,16-17H2,(H,28,32)/b6-5+/t20-/m0/s1 |
| InChIKey | JXCSPNRNFQSNQE-XJDXJNMNSA-N |
| XLogP | 2.77 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |