C29H35FN8O3 — CID 166459691
tert-butyl 4-[2-[(10S)-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]pyrimidin-5-yl]piperidine-1-carboxylate (PubChem CID 166459691) has the molecular formula C29H35FN8O3 and a molecular weight of 562.65 g/mol. Its IUPAC name is tert-butyl 4-[2-[(10S)-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]pyrimidin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(10S)-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]pyrimidin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166459691 |
| Molecular Formula | C29H35FN8O3 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | tert-butyl 4-[2-[(10S)-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]pyrimidin-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cnc(N3CCN4c5cc(-c6cccc(F)c6O)nnc5NC[C@H]4C3)nc2)CC1 |
| InChI | InChI=1S/C29H35FN8O3/c1-29(2,3)41-28(40)36-9-7-18(8-10-36)19-14-32-27(33-15-19)37-11-12-38-20(17-37)16-31-26-24(38)13-23(34-35-26)21-5-4-6-22(30)25(21)39/h4-6,13-15,18,20,39H,7-12,16-17H2,1-3H3,(H,31,35)/t20-/m0/s1 |
| InChIKey | GKIQVALYVUKTCF-FQEVSTJZSA-N |
| XLogP | 4.01 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |