C16H15FN4O3 — CID 171098160
(4R,6R)-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-4-carboxylic acid (PubChem CID 171098160) has the molecular formula C16H15FN4O3 and a molecular weight of 330.32 g/mol. Its IUPAC name is (4R,6R)-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-4-carboxylic acid.
| Compound Name | (4R,6R)-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 171098160 |
| Molecular Formula | C16H15FN4O3 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (4R,6R)-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H]2CNc3nnc(-c4cccc(F)c4O)cc3N2C1 |
| InChI | InChI=1S/C16H15FN4O3/c17-11-3-1-2-10(14(11)22)12-5-13-15(20-19-12)18-6-9-4-8(16(23)24)7-21(9)13/h1-3,5,8-9,22H,4,6-7H2,(H,18,20)(H,23,24)/t8-,9-/m1/s1 |
| InChIKey | VAXVVNOQCWBANV-RKDXNWHRSA-N |
| XLogP | 1.69 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |