C24H25FN6O4 — CID 174322607
ethyl 2-[[12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-4,6-dimethylpyrimidine-5-carboxylate (PubChem CID 174322607) has the molecular formula C24H25FN6O4 and a molecular weight of 480.50 g/mol. Its IUPAC name is ethyl 2-[[12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-4,6-dimethylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[[12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-4,6-dimethylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 174322607 |
| Molecular Formula | C24H25FN6O4 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | ethyl 2-[[12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-4,6-dimethylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(OC2CC3CNc4nnc(-c5cccc(F)c5O)cc4N3C2)nc1C |
| InChI | InChI=1S/C24H25FN6O4/c1-4-34-23(33)20-12(2)27-24(28-13(20)3)35-15-8-14-10-26-22-19(31(14)11-15)9-18(29-30-22)16-6-5-7-17(25)21(16)32/h5-7,9,14-15,32H,4,8,10-11H2,1-3H3,(H,26,30) |
| InChIKey | WANVZUFVKSYBBM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 122.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |