C24H25FN6O2 — CID 171098418
2-[(4R,6R)-4-(5-ethenyl-6-methylpyrazin-2-yl)oxy-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol (PubChem CID 171098418) has the molecular formula C24H25FN6O2 and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-[(4R,6R)-4-(5-ethenyl-6-methylpyrazin-2-yl)oxy-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol.
| Compound Name | 2-[(4R,6R)-4-(5-ethenyl-6-methylpyrazin-2-yl)oxy-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol |
|---|---|
| PubChem CID | 171098418 |
| Molecular Formula | C24H25FN6O2 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[(4R,6R)-4-(5-ethenyl-6-methylpyrazin-2-yl)oxy-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol |
| SMILES | C=Cc1ncc(O[C@H]2CN3c4cc(-c5cccc(F)c5O)nnc4NC[C@@]3(CC)C2)nc1C |
| InChI | InChI=1S/C24H25FN6O2/c1-4-18-14(3)28-21(11-26-18)33-15-10-24(5-2)13-27-23-20(31(24)12-15)9-19(29-30-23)16-7-6-8-17(25)22(16)32/h4,6-9,11,15,32H,1,5,10,12-13H2,2-3H3,(H,27,30)/t15-,24-/m1/s1 |
| InChIKey | UZLWYICUVHIOBE-OYLFLEFRSA-N |
| XLogP | 3.96 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |