C27H31N5O5 — CID 176880365
(4R,6S)-4-[[5-(1,3-dioxolan-2-yl)-2-pyridinyl]oxy]-6-ethyl-12-[2-(methoxymethoxy)phenyl]-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene (PubChem CID 176880365) has the molecular formula C27H31N5O5 and a molecular weight of 505.58 g/mol. Its IUPAC name is (4R,6S)-4-[[5-(1,3-dioxolan-2-yl)-2-pyridinyl]oxy]-6-ethyl-12-[2-(methoxymethoxy)phenyl]-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene.
| Compound Name | (4R,6S)-4-[[5-(1,3-dioxolan-2-yl)-2-pyridinyl]oxy]-6-ethyl-12-[2-(methoxymethoxy)phenyl]-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 176880365 |
| Molecular Formula | C27H31N5O5 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (4R,6S)-4-[[5-(1,3-dioxolan-2-yl)-2-pyridinyl]oxy]-6-ethyl-12-[2-(methoxymethoxy)phenyl]-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
| SMILES | CC[C@]12CNc3nnc(-c4ccccc4OCOC)cc3N1C[C@H](Oc1ccc(C3OCCO3)cn1)C2 |
| InChI | InChI=1S/C27H31N5O5/c1-3-27-13-19(37-24-9-8-18(14-28-24)26-34-10-11-35-26)15-32(27)22-12-21(30-31-25(22)29-16-27)20-6-4-5-7-23(20)36-17-33-2/h4-9,12,14,19,26H,3,10-11,13,15-17H2,1-2H3,(H,29,31)/t19-,27+/m1/s1 |
| InChIKey | MESKBOKSCXQNAH-WINIVTDRSA-N |
| XLogP | 3.80 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|