C19H22ClN5O — CID 171098357
(4R,6S)-12-chloro-4-[(5-ethenyl-4-methyl-2-pyridinyl)oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene (PubChem CID 171098357) has the molecular formula C19H22ClN5O and a molecular weight of 371.87 g/mol. Its IUPAC name is (4R,6S)-12-chloro-4-[(5-ethenyl-4-methyl-2-pyridinyl)oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene.
| Compound Name | (4R,6S)-12-chloro-4-[(5-ethenyl-4-methyl-2-pyridinyl)oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 171098357 |
| Molecular Formula | C19H22ClN5O |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (4R,6S)-12-chloro-4-[(5-ethenyl-4-methyl-2-pyridinyl)oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
| SMILES | C=Cc1cnc(O[C@H]2CN3c4cc(Cl)nnc4NC[C@]3(CC)C2)cc1C |
| InChI | InChI=1S/C19H22ClN5O/c1-4-13-9-21-17(6-12(13)3)26-14-8-19(5-2)11-22-18-15(25(19)10-14)7-16(20)23-24-18/h4,6-7,9,14H,1,5,8,10-11H2,2-3H3,(H,22,24)/t14-,19+/m1/s1 |
| InChIKey | BBJIMKFTDFKRTG-KUHUBIRLSA-N |
| XLogP | 3.71 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |