C24H21F4N5O3 — CID 171098513
6-[[(4R,6S)-6-(difluoromethyl)-12-(3-fluoro-2-methoxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-5-fluoro-4-methylpyridine-3-carbaldehyde (PubChem CID 171098513) has the molecular formula C24H21F4N5O3 and a molecular weight of 503.46 g/mol. Its IUPAC name is 6-[[(4R,6S)-6-(difluoromethyl)-12-(3-fluoro-2-methoxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-5-fluoro-4-methylpyridine-3-carbaldehyde.
| Compound Name | 6-[[(4R,6S)-6-(difluoromethyl)-12-(3-fluoro-2-methoxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-5-fluoro-4-methylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 171098513 |
| Molecular Formula | C24H21F4N5O3 |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 6-[[(4R,6S)-6-(difluoromethyl)-12-(3-fluoro-2-methoxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-5-fluoro-4-methylpyridine-3-carbaldehyde |
| SMILES | COc1c(F)cccc1-c1cc2c(nn1)NC[C@]1(C(F)F)C[C@@H](Oc3ncc(C=O)c(C)c3F)CN21 |
| InChI | InChI=1S/C24H21F4N5O3/c1-12-13(10-34)8-29-22(19(12)26)36-14-7-24(23(27)28)11-30-21-18(33(24)9-14)6-17(31-32-21)15-4-3-5-16(25)20(15)35-2/h3-6,8,10,14,23H,7,9,11H2,1-2H3,(H,30,32)/t14-,24+/m1/s1 |
| InChIKey | WGPWFACEBFHHQD-SHACYNPGSA-N |
| XLogP | 4.03 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|