C22H27F2N5O3 — CID 170330113
tert-butyl 4-(3-fluoro-2-methoxyphenyl)-10-(fluoromethyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate (PubChem CID 170330113) has the molecular formula C22H27F2N5O3 and a molecular weight of 447.49 g/mol. Its IUPAC name is tert-butyl 4-(3-fluoro-2-methoxyphenyl)-10-(fluoromethyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate.
| Compound Name | tert-butyl 4-(3-fluoro-2-methoxyphenyl)-10-(fluoromethyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate |
|---|---|
| PubChem CID | 170330113 |
| Molecular Formula | C22H27F2N5O3 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | tert-butyl 4-(3-fluoro-2-methoxyphenyl)-10-(fluoromethyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate |
| SMILES | COc1c(F)cccc1-c1cc2c(nn1)NCC1(CF)CN(C(=O)OC(C)(C)C)CCN21 |
| InChI | InChI=1S/C22H27F2N5O3/c1-21(2,3)32-20(30)28-8-9-29-17-10-16(14-6-5-7-15(24)18(14)31-4)26-27-19(17)25-12-22(29,11-23)13-28/h5-7,10H,8-9,11-13H2,1-4H3,(H,25,27) |
| InChIKey | OGVIBLDKGWQGJI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |