C21H27N5O3 — CID 176880418
tert-butyl (9S,10S)-4-(2-hydroxyphenyl)-9-methyl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate (PubChem CID 176880418) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl (9S,10S)-4-(2-hydroxyphenyl)-9-methyl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate.
| Compound Name | tert-butyl (9S,10S)-4-(2-hydroxyphenyl)-9-methyl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate |
|---|---|
| PubChem CID | 176880418 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | tert-butyl (9S,10S)-4-(2-hydroxyphenyl)-9-methyl-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate |
| SMILES | C[C@@H]1Nc2nnc(-c3ccccc3O)cc2N2CCN(C(=O)OC(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C21H27N5O3/c1-13-17-12-25(20(28)29-21(2,3)4)9-10-26(17)16-11-15(23-24-19(16)22-13)14-7-5-6-8-18(14)27/h5-8,11,13,17,27H,9-10,12H2,1-4H3,(H,22,24)/t13-,17-/m0/s1 |
| InChIKey | KOZACUGMRZYILI-GUYCJALGSA-N |
| XLogP | 3.09 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |