C23H29FN4O4 — CID 171098555
tert-butyl (4R,6R)-6-ethyl-12-(3-fluoro-2-methoxyphenyl)-4-hydroxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate (PubChem CID 171098555) has the molecular formula C23H29FN4O4 and a molecular weight of 444.51 g/mol. Its IUPAC name is tert-butyl (4R,6R)-6-ethyl-12-(3-fluoro-2-methoxyphenyl)-4-hydroxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate.
| Compound Name | tert-butyl (4R,6R)-6-ethyl-12-(3-fluoro-2-methoxyphenyl)-4-hydroxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate |
|---|---|
| PubChem CID | 171098555 |
| Molecular Formula | C23H29FN4O4 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | tert-butyl (4R,6R)-6-ethyl-12-(3-fluoro-2-methoxyphenyl)-4-hydroxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate |
| SMILES | CC[C@]12C[C@@H](O)CN1c1cc(-c3cccc(F)c3OC)nnc1N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C23H29FN4O4/c1-6-23-11-14(29)12-28(23)18-10-17(15-8-7-9-16(24)19(15)31-5)25-26-20(18)27(13-23)21(30)32-22(2,3)4/h7-10,14,29H,6,11-13H2,1-5H3/t14-,23-/m1/s1 |
| InChIKey | KEJQVBJPSFZWRB-QKFKETGDSA-N |
| XLogP | 3.77 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |