C22H27ClN4O3 — CID 171098175
tert-butyl (4R,6R)-12-chloro-6-methyl-4-phenylmethoxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate (PubChem CID 171098175) has the molecular formula C22H27ClN4O3 and a molecular weight of 430.94 g/mol. Its IUPAC name is tert-butyl (4R,6R)-12-chloro-6-methyl-4-phenylmethoxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate.
| Compound Name | tert-butyl (4R,6R)-12-chloro-6-methyl-4-phenylmethoxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate |
|---|---|
| PubChem CID | 171098175 |
| Molecular Formula | C22H27ClN4O3 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | tert-butyl (4R,6R)-12-chloro-6-methyl-4-phenylmethoxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@]2(C)C[C@@H](OCc3ccccc3)CN2c2cc(Cl)nnc21 |
| InChI | InChI=1S/C22H27ClN4O3/c1-21(2,3)30-20(28)26-14-22(4)11-16(29-13-15-8-6-5-7-9-15)12-27(22)17-10-18(23)24-25-19(17)26/h5-10,16H,11-14H2,1-4H3/t16-,22-/m1/s1 |
| InChIKey | QXBREGQGQDQERM-OPAMFIHVSA-N |
| XLogP | 4.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |