C20H31NO4 — CID 156701929
tert-butyl 3-(2-hydroxypropan-2-yl)-5-phenylmethoxypiperidine-1-carboxylate (PubChem CID 156701929) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl 3-(2-hydroxypropan-2-yl)-5-phenylmethoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-hydroxypropan-2-yl)-5-phenylmethoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 156701929 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | tert-butyl 3-(2-hydroxypropan-2-yl)-5-phenylmethoxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCc2ccccc2)CC(C(C)(C)O)C1 |
| InChI | InChI=1S/C20H31NO4/c1-19(2,3)25-18(22)21-12-16(20(4,5)23)11-17(13-21)24-14-15-9-7-6-8-10-15/h6-10,16-17,23H,11-14H2,1-5H3 |
| InChIKey | UFZGOYCUIVTSKU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |