C14H19ClN4O3 — CID 171098381
tert-butyl (4R,6S)-12-chloro-4-hydroxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate (PubChem CID 171098381) has the molecular formula C14H19ClN4O3 and a molecular weight of 326.78 g/mol. Its IUPAC name is tert-butyl (4R,6S)-12-chloro-4-hydroxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate.
| Compound Name | tert-butyl (4R,6S)-12-chloro-4-hydroxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate |
|---|---|
| PubChem CID | 171098381 |
| Molecular Formula | C14H19ClN4O3 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | tert-butyl (4R,6S)-12-chloro-4-hydroxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@@H](O)CN2c2cc(Cl)nnc21 |
| InChI | InChI=1S/C14H19ClN4O3/c1-14(2,3)22-13(21)19-6-8-4-9(20)7-18(8)10-5-11(15)16-17-12(10)19/h5,8-9,20H,4,6-7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | KZZMPHPDNGHETI-DTWKUNHWSA-N |
| XLogP | 1.82 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |