C14H18Cl2N4O3 — CID 176880192
tert-butyl (3S)-4-(3,6-dichloropyridazin-4-yl)-3-formylpiperazine-1-carboxylate (PubChem CID 176880192) has the molecular formula C14H18Cl2N4O3 and a molecular weight of 361.23 g/mol. Its IUPAC name is tert-butyl (3S)-4-(3,6-dichloropyridazin-4-yl)-3-formylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(3,6-dichloropyridazin-4-yl)-3-formylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176880192 |
| Molecular Formula | C14H18Cl2N4O3 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | tert-butyl (3S)-4-(3,6-dichloropyridazin-4-yl)-3-formylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(Cl)nnc2Cl)[C@H](C=O)C1 |
| InChI | InChI=1S/C14H18Cl2N4O3/c1-14(2,3)23-13(22)19-4-5-20(9(7-19)8-21)10-6-11(15)17-18-12(10)16/h6,8-9H,4-5,7H2,1-3H3/t9-/m0/s1 |
| InChIKey | UVCWYOPSNUJVCA-VIFPVBQESA-N |
| XLogP | 2.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|