C11H14Cl2N4O2 — CID 114011878
ethyl 4-(3,6-dichloropyridazin-4-yl)piperazine-1-carboxylate (PubChem CID 114011878) has the molecular formula C11H14Cl2N4O2 and a molecular weight of 305.17 g/mol. Its IUPAC name is ethyl 4-(3,6-dichloropyridazin-4-yl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(3,6-dichloropyridazin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 114011878 |
| Molecular Formula | C11H14Cl2N4O2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | ethyl 4-(3,6-dichloropyridazin-4-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(Cl)nnc2Cl)CC1 |
| InChI | InChI=1S/C11H14Cl2N4O2/c1-2-19-11(18)17-5-3-16(4-6-17)8-7-9(12)14-15-10(8)13/h7H,2-6H2,1H3 |
| InChIKey | DGXRHBLJSHWGTR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |