C24H33FN2O8 — CID 170306810
tert-butyl 5-(4,4-dimethoxybutyl)-3-[(3-fluoro-2-methoxyphenyl)carbamoyl]-2,4-dioxopiperidine-1-carboxylate (PubChem CID 170306810) has the molecular formula C24H33FN2O8 and a molecular weight of 496.53 g/mol. Its IUPAC name is tert-butyl 5-(4,4-dimethoxybutyl)-3-[(3-fluoro-2-methoxyphenyl)carbamoyl]-2,4-dioxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 5-(4,4-dimethoxybutyl)-3-[(3-fluoro-2-methoxyphenyl)carbamoyl]-2,4-dioxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170306810 |
| Molecular Formula | C24H33FN2O8 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | tert-butyl 5-(4,4-dimethoxybutyl)-3-[(3-fluoro-2-methoxyphenyl)carbamoyl]-2,4-dioxopiperidine-1-carboxylate |
| SMILES | COc1c(F)cccc1NC(=O)C1C(=O)C(CCCC(OC)OC)CN(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C24H33FN2O8/c1-24(2,3)35-23(31)27-13-14(9-7-12-17(32-4)33-5)19(28)18(22(27)30)21(29)26-16-11-8-10-15(25)20(16)34-6/h8,10-11,14,17-18H,7,9,12-13H2,1-6H3,(H,26,29) |
| InChIKey | SJRATBYWHOLIRX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|