C18H22ClN5O2 — CID 176880312
[6-[[(4R,6S)-12-chloro-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-5-methyl-3-pyridinyl]methanol (PubChem CID 176880312) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is [6-[[(4R,6S)-12-chloro-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-5-methyl-3-pyridinyl]methanol.
| Compound Name | [6-[[(4R,6S)-12-chloro-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-5-methyl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 176880312 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [6-[[(4R,6S)-12-chloro-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-5-methyl-3-pyridinyl]methanol |
| SMILES | CC[C@]12CNc3nnc(Cl)cc3N1C[C@H](Oc1ncc(CO)cc1C)C2 |
| InChI | InChI=1S/C18H22ClN5O2/c1-3-18-6-13(26-17-11(2)4-12(9-25)7-20-17)8-24(18)14-5-15(19)22-23-16(14)21-10-18/h4-5,7,13,25H,3,6,8-10H2,1-2H3,(H,21,23)/t13-,18+/m1/s1 |
| InChIKey | DZLPVIPZGPSSIE-ACJLOTCBSA-N |
| XLogP | 2.56 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |