C20H24ClN5O3 — CID 176880242
(4R,6S)-12-chloro-4-[[5-(1,3-dioxolan-2-yl)-3-methyl-2-pyridinyl]oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene (PubChem CID 176880242) has the molecular formula C20H24ClN5O3 and a molecular weight of 417.90 g/mol. Its IUPAC name is (4R,6S)-12-chloro-4-[[5-(1,3-dioxolan-2-yl)-3-methyl-2-pyridinyl]oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene.
| Compound Name | (4R,6S)-12-chloro-4-[[5-(1,3-dioxolan-2-yl)-3-methyl-2-pyridinyl]oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 176880242 |
| Molecular Formula | C20H24ClN5O3 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (4R,6S)-12-chloro-4-[[5-(1,3-dioxolan-2-yl)-3-methyl-2-pyridinyl]oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
| SMILES | CC[C@]12CNc3nnc(Cl)cc3N1C[C@H](Oc1ncc(C3OCCO3)cc1C)C2 |
| InChI | InChI=1S/C20H24ClN5O3/c1-3-20-8-14(10-26(20)15-7-16(21)24-25-17(15)23-11-20)29-18-12(2)6-13(9-22-18)19-27-4-5-28-19/h6-7,9,14,19H,3-5,8,10-11H2,1-2H3,(H,23,25)/t14-,20+/m1/s1 |
| InChIKey | RLZQEQITXINJOP-VLIAUNLRSA-N |
| XLogP | 3.11 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |