C17H17ClN4O2 — CID 176880286
(4R,6S)-12-chloro-6-methyl-4-phenylmethoxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-7-one (PubChem CID 176880286) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is (4R,6S)-12-chloro-6-methyl-4-phenylmethoxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-7-one.
| Compound Name | (4R,6S)-12-chloro-6-methyl-4-phenylmethoxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-7-one |
|---|---|
| PubChem CID | 176880286 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (4R,6S)-12-chloro-6-methyl-4-phenylmethoxy-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-7-one |
| SMILES | C[C@@]12C[C@@H](OCc3ccccc3)CN1c1cc(Cl)nnc1NC2=O |
| InChI | InChI=1S/C17H17ClN4O2/c1-17-8-12(24-10-11-5-3-2-4-6-11)9-22(17)13-7-14(18)20-21-15(13)19-16(17)23/h2-7,12H,8-10H2,1H3,(H,19,21,23)/t12-,17+/m1/s1 |
| InChIKey | QTPDEBBRIFYYNV-PXAZEXFGSA-N |
| XLogP | 2.64 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |