C24H32FN7O2 — CID 170336918
[(2R,5S)-2,5-dimethylpiperazin-1-yl]-[10-ethyl-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]methanone (PubChem CID 170336918) has the molecular formula C24H32FN7O2 and a molecular weight of 469.57 g/mol. Its IUPAC name is [(2R,5S)-2,5-dimethylpiperazin-1-yl]-[10-ethyl-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]methanone.
| Compound Name | [(2R,5S)-2,5-dimethylpiperazin-1-yl]-[10-ethyl-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]methanone |
|---|---|
| PubChem CID | 170336918 |
| Molecular Formula | C24H32FN7O2 |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | [(2R,5S)-2,5-dimethylpiperazin-1-yl]-[10-ethyl-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]methanone |
| SMILES | CCC12CNc3nnc(-c4cccc(F)c4O)cc3N1CCN(C(=O)N1C[C@H](C)NC[C@H]1C)C2 |
| InChI | InChI=1S/C24H32FN7O2/c1-4-24-13-27-22-20(10-19(28-29-22)17-6-5-7-18(25)21(17)33)32(24)9-8-30(14-24)23(34)31-12-15(2)26-11-16(31)3/h5-7,10,15-16,26,33H,4,8-9,11-14H2,1-3H3,(H,27,29)/t15-,16+,24?/m0/s1 |
| InChIKey | LPZGDQCYBOQSDA-CAFRZEFWSA-N |
| XLogP | 2.49 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |