C25H21FN6O2 — CID 177021475
2-[4-[(6-ethenyl-1,8-naphthyridin-2-yl)oxy]-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol (PubChem CID 177021475) has the molecular formula C25H21FN6O2 and a molecular weight of 456.48 g/mol. Its IUPAC name is 2-[4-[(6-ethenyl-1,8-naphthyridin-2-yl)oxy]-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol.
| Compound Name | 2-[4-[(6-ethenyl-1,8-naphthyridin-2-yl)oxy]-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol |
|---|---|
| PubChem CID | 177021475 |
| Molecular Formula | C25H21FN6O2 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-[4-[(6-ethenyl-1,8-naphthyridin-2-yl)oxy]-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol |
| SMILES | C=Cc1cnc2nc(OC3CC4CNc5nnc(-c6cccc(F)c6O)cc5N4C3)ccc2c1 |
| InChI | InChI=1S/C25H21FN6O2/c1-2-14-8-15-6-7-22(29-24(15)27-11-14)34-17-9-16-12-28-25-21(32(16)13-17)10-20(30-31-25)18-4-3-5-19(26)23(18)33/h2-8,10-11,16-17,33H,1,9,12-13H2,(H,28,31) |
| InChIKey | RHGWTGWXSGAOAI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |