C20H26ClN5O3 — CID 170613290
tert-butyl 4-(5-chloro-6-hydroxycyclohexa-1,5-dien-1-yl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate (PubChem CID 170613290) has the molecular formula C20H26ClN5O3 and a molecular weight of 419.91 g/mol. Its IUPAC name is tert-butyl 4-(5-chloro-6-hydroxycyclohexa-1,5-dien-1-yl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate.
| Compound Name | tert-butyl 4-(5-chloro-6-hydroxycyclohexa-1,5-dien-1-yl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate |
|---|---|
| PubChem CID | 170613290 |
| Molecular Formula | C20H26ClN5O3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | tert-butyl 4-(5-chloro-6-hydroxycyclohexa-1,5-dien-1-yl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3cc(C4=CCCC(Cl)=C4O)nnc3NCC2C1 |
| InChI | InChI=1S/C20H26ClN5O3/c1-20(2,3)29-19(28)25-7-8-26-12(11-25)10-22-18-16(26)9-15(23-24-18)13-5-4-6-14(21)17(13)27/h5,9,12,27H,4,6-8,10-11H2,1-3H3,(H,22,24) |
| InChIKey | NGTLPWQRLNBHOJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |