C24H29N5O2 — CID 67184415
tert-butyl 4-[3-(3-aminophenyl)-4-pyridin-4-ylpyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 67184415) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is tert-butyl 4-[3-(3-aminophenyl)-4-pyridin-4-ylpyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(3-aminophenyl)-4-pyridin-4-ylpyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67184415 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | tert-butyl 4-[3-(3-aminophenyl)-4-pyridin-4-ylpyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3ccncc3)c(-c3cccc(N)c3)n2)CC1 |
| InChI | InChI=1S/C24H29N5O2/c1-24(2,3)31-23(30)28-13-9-20(10-14-28)29-16-21(17-7-11-26-12-8-17)22(27-29)18-5-4-6-19(25)15-18/h4-8,11-12,15-16,20H,9-10,13-14,25H2,1-3H3 |
| InChIKey | GIBHKZLMEUDLER-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|