C28H26N6O3 — CID 177374978
5-cyclopropyl-N-[3-[1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4-pyridin-4-ylpyrazol-3-yl]phenyl]-1,3-oxazole-2-carboxamide (PubChem CID 177374978) has the molecular formula C28H26N6O3 and a molecular weight of 494.56 g/mol. Its IUPAC name is 5-cyclopropyl-N-[3-[1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4-pyridin-4-ylpyrazol-3-yl]phenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | 5-cyclopropyl-N-[3-[1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4-pyridin-4-ylpyrazol-3-yl]phenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 177374978 |
| Molecular Formula | C28H26N6O3 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 5-cyclopropyl-N-[3-[1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4-pyridin-4-ylpyrazol-3-yl]phenyl]-1,3-oxazole-2-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H](n2cc(-c3ccncc3)c(-c3cccc(NC(=O)c4ncc(C5CC5)o4)c3)n2)C1 |
| InChI | InChI=1S/C28H26N6O3/c1-2-25(35)33-13-10-22(16-33)34-17-23(18-8-11-29-12-9-18)26(32-34)20-4-3-5-21(14-20)31-27(36)28-30-15-24(37-28)19-6-7-19/h2-5,8-9,11-12,14-15,17,19,22H,1,6-7,10,13,16H2,(H,31,36)/t22-/m0/s1 |
| InChIKey | VBXIMDTVPRQNND-QFIPXVFZSA-N |
| XLogP | 4.69 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|